C27H22ClN7O4S2 — CID 67070934
1-[3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2-[3-[3-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]phenyl]ethane-1,2-diol (PubChem CID 67070934) has the molecular formula C27H22ClN7O4S2 and a molecular weight of 608.11 g/mol. Its IUPAC name is 1-[3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2-[3-[3-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]phenyl]ethane-1,2-diol.
| Compound Name | 1-[3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2-[3-[3-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 67070934 |
| Molecular Formula | C27H22ClN7O4S2 |
| Molecular Weight | 608.11 g/mol |
| Exact Mass | 607.09 |
| IUPAC Name | 1-[3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2-[3-[3-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]phenyl]ethane-1,2-diol |
| SMILES | Cn1c(SCc2noc(-c3cccc(C(O)C(O)c4cccc(-c5nc(CCl)no5)c4)c3)n2)nnc1-c1cccs1 |
| InChI | InChI=1S/C27H22ClN7O4S2/c1-35-24(19-9-4-10-40-19)31-32-27(35)41-14-21-30-26(39-34-21)18-8-3-6-16(12-18)23(37)22(36)15-5-2-7-17(11-15)25-29-20(13-28)33-38-25/h2-12,22-23,36-37H,13-14H2,1H3 |
| InChIKey | SVMKKQNJFNAZDF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.11 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|