C13H13ClN2O3 — CID 67070965
methyl (3R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoate (PubChem CID 67070965) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is methyl (3R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoate.
| Compound Name | methyl (3R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 67070965 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | methyl (3R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoate |
| SMILES | COC(=O)C[C@@H](C)c1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C13H13ClN2O3/c1-8(6-11(17)18-2)13-15-12(16-19-13)9-4-3-5-10(14)7-9/h3-5,7-8H,6H2,1-2H3/t8-/m1/s1 |
| InChIKey | KFSJINZEJVWVDA-MRVPVSSYSA-N |
| XLogP | 3.06 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |