C20H16ClFN6O — CID 67071018
5-(5-chloro-2-fluorophenyl)-3-[(3-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)methyl]-1,2,4-oxadiazole (PubChem CID 67071018) has the molecular formula C20H16ClFN6O and a molecular weight of 410.84 g/mol. Its IUPAC name is 5-(5-chloro-2-fluorophenyl)-3-[(3-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-(5-chloro-2-fluorophenyl)-3-[(3-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67071018 |
| Molecular Formula | C20H16ClFN6O |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 5-(5-chloro-2-fluorophenyl)-3-[(3-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)methyl]-1,2,4-oxadiazole |
| SMILES | Fc1ccc(Cl)cc1-c1nc(CC2CCCn3c(-c4ccncc4)nnc32)no1 |
| InChI | InChI=1S/C20H16ClFN6O/c21-14-3-4-16(22)15(11-14)20-24-17(27-29-20)10-13-2-1-9-28-18(25-26-19(13)28)12-5-7-23-8-6-12/h3-8,11,13H,1-2,9-10H2 |
| InChIKey | PMENQUKDXQSVHT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |