About 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol
1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol (PubChem CID 67071208) has the molecular formula C22H25FN2O4
and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol |
| PubChem CID | 67071208 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccc(OCC(O)CC2(c3noc4cc(F)ccc34)CCNCC2)cc1 |
| InChI | InChI=1S/C22H25FN2O4/c1-27-17-3-5-18(6-4-17)28-14-16(26)13-22(8-10-24-11-9-22)21-19-7-2-15(23)12-20(19)29-25-21/h2-7,12,16,24,26H,8-11,13-14H2,1H3 |
| InChIKey | MRBSTOWZJSAHOR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol?
The IUPAC name of 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol (CID 67071208) is 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol.
What is the SMILES notation for 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol?
The canonical SMILES for 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol is COc1ccc(OCC(O)CC2(c3noc4cc(F)ccc34)CCNCC2)cc1.
What is the InChIKey of 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol?
The InChIKey is MRBSTOWZJSAHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN2O4/c1-27-17-3-5-18(6-4-17)28-14-16(26)13-22(8-10-24-11-9-22)21-19-7-2-15(23)12-20(19)29-25-21/h2-7,12,16,24,26H,8-11,13-14H2,1H3.
What are the key properties of 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol?
1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol has a molecular weight of 400.45 g/mol, XLogP of 3.43, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-4-yl]-3-(4-methoxyphenoxy)propan-2-ol is sourced from PubChem (CID 67071208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).