C22H31N3O2S — CID 67071234
4-[(dimethylamino)methyl]-N-[4-(1-propylpyrrolidin-3-yl)phenyl]benzenesulfonamide (PubChem CID 67071234) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-N-[4-(1-propylpyrrolidin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-[(dimethylamino)methyl]-N-[4-(1-propylpyrrolidin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67071234 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 4-[(dimethylamino)methyl]-N-[4-(1-propylpyrrolidin-3-yl)phenyl]benzenesulfonamide |
| SMILES | CCCN1CCC(c2ccc(NS(=O)(=O)c3ccc(CN(C)C)cc3)cc2)C1 |
| InChI | InChI=1S/C22H31N3O2S/c1-4-14-25-15-13-20(17-25)19-7-9-21(10-8-19)23-28(26,27)22-11-5-18(6-12-22)16-24(2)3/h5-12,20,23H,4,13-17H2,1-3H3 |
| InChIKey | XAAPYHYQYYKMLD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |