About (5-hydroxy-2-pyridinyl) hydrogen carbonate
(5-hydroxy-2-pyridinyl) hydrogen carbonate (PubChem CID 67072621) has the molecular formula C6H5NO4
and a molecular weight of 155.11 g/mol. Its IUPAC name is (5-hydroxy-2-pyridinyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (5-hydroxy-2-pyridinyl) hydrogen carbonate |
| PubChem CID | 67072621 |
| Molecular Formula | C6H5NO4 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | (5-hydroxy-2-pyridinyl) hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc(O)cn1 |
| InChI | InChI=1S/C6H5NO4/c8-4-1-2-5(7-3-4)11-6(9)10/h1-3,8H,(H,9,10) |
| InChIKey | PKLTVAZCEUEDKH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-hydroxy-2-pyridinyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-2-pyridinyl) hydrogen carbonate?
The IUPAC name of (5-hydroxy-2-pyridinyl) hydrogen carbonate (CID 67072621) is (5-hydroxy-2-pyridinyl) hydrogen carbonate.
What is the SMILES notation for (5-hydroxy-2-pyridinyl) hydrogen carbonate?
The canonical SMILES for (5-hydroxy-2-pyridinyl) hydrogen carbonate is O=C(O)Oc1ccc(O)cn1.
What is the InChIKey of (5-hydroxy-2-pyridinyl) hydrogen carbonate?
The InChIKey is PKLTVAZCEUEDKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4/c8-4-1-2-5(7-3-4)11-6(9)10/h1-3,8H,(H,9,10).
What are the key properties of (5-hydroxy-2-pyridinyl) hydrogen carbonate?
(5-hydroxy-2-pyridinyl) hydrogen carbonate has a molecular weight of 155.11 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-2-pyridinyl) hydrogen carbonate is sourced from PubChem (CID 67072621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).