C17H23N5 — CID 67072807
2-N-(4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 67072807) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-N-(4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67072807 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 2-N-(4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1nc(N)nc(NC2CCC(C)c3cc(C)ccc32)n1 |
| InChI | InChI=1S/C17H23N5/c1-4-15-20-16(18)22-17(21-15)19-14-8-6-11(3)13-9-10(2)5-7-12(13)14/h5,7,9,11,14H,4,6,8H2,1-3H3,(H3,18,19,20,21,22) |
| InChIKey | GMVFTAWWBLSYLE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |