C27H40ClP — CID 67073051
2-chlorohexyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 67073051) has the molecular formula C27H40ClP and a molecular weight of 431.04 g/mol. Its IUPAC name is 2-chlorohexyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane.
| Compound Name | 2-chlorohexyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 67073051 |
| Molecular Formula | C27H40ClP |
| Molecular Weight | 431.04 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-chlorohexyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | CCCCC(Cl)CPc1ccccc1-c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C27H40ClP/c1-8-9-12-22(28)17-29-26-14-11-10-13-23(26)27-24(19(4)5)15-21(18(2)3)16-25(27)20(6)7/h10-11,13-16,18-20,22,29H,8-9,12,17H2,1-7H3 |
| InChIKey | SCXSMOCTUYMTRE-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.04 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|