About (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine
(2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine (PubChem CID 67073069) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine.
Molecular Properties
| Compound Name | (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine |
| PubChem CID | 67073069 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine |
| SMILES | C1=CC2=C([C@@H]3CNCCO3)CCC2=CO1 |
| InChI | InChI=1S/C12H15NO2/c1-2-11(12-7-13-4-6-15-12)10-3-5-14-8-9(1)10/h3,5,8,12-13H,1-2,4,6-7H2/t12-/m0/s1 |
| InChIKey | VDHYUHJSVKJIMY-LBPRGKRZSA-N |
| XLogP | 1.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine?
The IUPAC name of (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine (CID 67073069) is (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine.
What is the SMILES notation for (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine?
The canonical SMILES for (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine is C1=CC2=C([C@@H]3CNCCO3)CCC2=CO1.
What is the InChIKey of (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine?
The InChIKey is VDHYUHJSVKJIMY-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-11(12-7-13-4-6-15-12)10-3-5-14-8-9(1)10/h3,5,8,12-13H,1-2,4,6-7H2/t12-/m0/s1.
What are the key properties of (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine?
(2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine has a molecular weight of 205.26 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(6,7-dihydrocyclopenta[c]pyran-5-yl)morpholine is sourced from PubChem (CID 67073069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).