C27H42O2S — CID 67073075
ethyl 1-icosa-5,8,11,14,17-pentaenylsulfanylcyclobutane-1-carboxylate (PubChem CID 67073075) has the molecular formula C27H42O2S and a molecular weight of 430.70 g/mol. Its IUPAC name is ethyl 1-icosa-5,8,11,14,17-pentaenylsulfanylcyclobutane-1-carboxylate.
| Compound Name | ethyl 1-icosa-5,8,11,14,17-pentaenylsulfanylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 67073075 |
| Molecular Formula | C27H42O2S |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | ethyl 1-icosa-5,8,11,14,17-pentaenylsulfanylcyclobutane-1-carboxylate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCSC1(C(=O)OCC)CCC1 |
| InChI | InChI=1S/C27H42O2S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-30-27(23-22-24-27)26(28)29-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-25H2,1-2H3 |
| InChIKey | PDJNBVFLPYRGJI-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|