About [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid
[(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid (PubChem CID 67073733) has the molecular formula C22H24N2O5
and a molecular weight of 396.44 g/mol. Its IUPAC name is [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid.
Molecular Properties
| Compound Name | [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid |
| PubChem CID | 67073733 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid |
| SMILES | CC[C@H](C)COc1ccc([C@H](CN2C(=O)c3ccccc3C2=O)NC(=O)O)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-3-14(2)13-29-16-10-8-15(9-11-16)19(23-22(27)28)12-24-20(25)17-6-4-5-7-18(17)21(24)26/h4-11,14,19,23H,3,12-13H2,1-2H3,(H,27,28)/t14-,19-/m0/s1 |
| InChIKey | LZDVHTQPBSDZOG-LIRRHRJNSA-N |
| XLogP | 3.72 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid?
The IUPAC name of [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid (CID 67073733) is [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid.
What is the SMILES notation for [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid?
The canonical SMILES for [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid is CC[C@H](C)COc1ccc([C@H](CN2C(=O)c3ccccc3C2=O)NC(=O)O)cc1.
What is the InChIKey of [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid?
The InChIKey is LZDVHTQPBSDZOG-LIRRHRJNSA-N. The full InChI is InChI=1S/C22H24N2O5/c1-3-14(2)13-29-16-10-8-15(9-11-16)19(23-22(27)28)12-24-20(25)17-6-4-5-7-18(17)21(24)26/h4-11,14,19,23H,3,12-13H2,1-2H3,(H,27,28)/t14-,19-/m0/s1.
What are the key properties of [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid?
[(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid has a molecular weight of 396.44 g/mol, XLogP of 3.72, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-(1,3-dioxoisoindol-2-yl)-1-[4-[(2S)-2-methylbutoxy]phenyl]ethyl]carbamic acid is sourced from PubChem (CID 67073733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).