C24H24F3N5O4 — CID 67073984
methyl 4-[[4-[(4-but-3-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 67073984) has the molecular formula C24H24F3N5O4 and a molecular weight of 503.48 g/mol. Its IUPAC name is methyl 4-[[4-[(4-but-3-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-[(4-but-3-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 67073984 |
| Molecular Formula | C24H24F3N5O4 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | methyl 4-[[4-[(4-but-3-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | C=CCCOc1ccc(CNc2nc(Nc3ccc(C(=O)OC)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C24H24F3N5O4/c1-3-4-13-35-19-11-5-16(6-12-19)14-28-21-30-22(32-23(31-21)36-15-24(25,26)27)29-18-9-7-17(8-10-18)20(33)34-2/h3,5-12H,1,4,13-15H2,2H3,(H2,28,29,30,31,32) |
| InChIKey | VOJYISWFJMLTEY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|