C29H33FN2O7 — CID 67074569
4-[2-[1-[(2S)-3-[[1-(3-fluoro-4-methylphenyl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]ethyl]phenoxy]-3-nitrobenzoic acid (PubChem CID 67074569) has the molecular formula C29H33FN2O7 and a molecular weight of 540.59 g/mol. Its IUPAC name is 4-[2-[1-[(2S)-3-[[1-(3-fluoro-4-methylphenyl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]ethyl]phenoxy]-3-nitrobenzoic acid.
| Compound Name | 4-[2-[1-[(2S)-3-[[1-(3-fluoro-4-methylphenyl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]ethyl]phenoxy]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 67074569 |
| Molecular Formula | C29H33FN2O7 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 4-[2-[1-[(2S)-3-[[1-(3-fluoro-4-methylphenyl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]ethyl]phenoxy]-3-nitrobenzoic acid |
| SMILES | Cc1ccc(CC(C)(C)NC[C@H](O)COC(C)c2ccccc2Oc2ccc(C(=O)O)cc2[N+](=O)[O-])cc1F |
| InChI | InChI=1S/C29H33FN2O7/c1-18-9-10-20(13-24(18)30)15-29(3,4)31-16-22(33)17-38-19(2)23-7-5-6-8-26(23)39-27-12-11-21(28(34)35)14-25(27)32(36)37/h5-14,19,22,31,33H,15-17H2,1-4H3,(H,34,35)/t19?,22-/m0/s1 |
| InChIKey | SAWATCACVYRQJZ-BPARTEKVSA-N |
| XLogP | 5.58 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|