C20H22F3N7O — CID 67074644
2-N-[4-(aminomethyl)phenyl]-4-N-[[3-(aminomethyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 67074644) has the molecular formula C20H22F3N7O and a molecular weight of 433.44 g/mol. Its IUPAC name is 2-N-[4-(aminomethyl)phenyl]-4-N-[[3-(aminomethyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-(aminomethyl)phenyl]-4-N-[[3-(aminomethyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67074644 |
| Molecular Formula | C20H22F3N7O |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-N-[4-(aminomethyl)phenyl]-4-N-[[3-(aminomethyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | NCc1ccc(Nc2nc(NCc3cccc(CN)c3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C20H22F3N7O/c21-20(22,23)12-31-19-29-17(26-11-15-3-1-2-14(8-15)10-25)28-18(30-19)27-16-6-4-13(9-24)5-7-16/h1-8H,9-12,24-25H2,(H2,26,27,28,29,30) |
| InChIKey | GXMMYKPLBLQXIF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |