C23H22F3N5O4 — CID 67074750
methyl 4-[[4-[(4-prop-2-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 67074750) has the molecular formula C23H22F3N5O4 and a molecular weight of 489.45 g/mol. Its IUPAC name is methyl 4-[[4-[(4-prop-2-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-[(4-prop-2-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 67074750 |
| Molecular Formula | C23H22F3N5O4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | methyl 4-[[4-[(4-prop-2-enoxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | C=CCOc1ccc(CNc2nc(Nc3ccc(C(=O)OC)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C23H22F3N5O4/c1-3-12-34-18-10-4-15(5-11-18)13-27-20-29-21(31-22(30-20)35-14-23(24,25)26)28-17-8-6-16(7-9-17)19(32)33-2/h3-11H,1,12-14H2,2H3,(H2,27,28,29,30,31) |
| InChIKey | PDRXHEQQECNVDV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|