C24H27F3N6O4 — CID 67074810
ethyl 4-[[4-[[4-(3-aminopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 67074810) has the molecular formula C24H27F3N6O4 and a molecular weight of 520.51 g/mol. Its IUPAC name is ethyl 4-[[4-[[4-(3-aminopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[[4-(3-aminopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 67074810 |
| Molecular Formula | C24H27F3N6O4 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | ethyl 4-[[4-[[4-(3-aminopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(NCc3ccc(OCCCN)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C24H27F3N6O4/c1-2-35-20(34)17-6-8-18(9-7-17)30-22-31-21(32-23(33-22)37-15-24(25,26)27)29-14-16-4-10-19(11-5-16)36-13-3-12-28/h4-11H,2-3,12-15,28H2,1H3,(H2,29,30,31,32,33) |
| InChIKey | DDHMMAKZXDXVJX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|