C40H44N4O4 — CID 67075012
(2S)-2-amino-N-[(2S)-1,1-diethoxypropan-2-yl]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide (PubChem CID 67075012) has the molecular formula C40H44N4O4 and a molecular weight of 644.82 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1,1-diethoxypropan-2-yl]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1,1-diethoxypropan-2-yl]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide |
|---|---|
| PubChem CID | 67075012 |
| Molecular Formula | C40H44N4O4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1,1-diethoxypropan-2-yl]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2cccnc12)C(=O)[C@@H](N)CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H44N4O4/c1-4-47-39(48-5-2)29(3)44(28-31-18-15-17-30-19-16-26-42-37(30)31)38(46)35(41)27-36(45)43-40(32-20-9-6-10-21-32,33-22-11-7-12-23-33)34-24-13-8-14-25-34/h6-26,29,35,39H,4-5,27-28,41H2,1-3H3,(H,43,45)/t29-,35-/m0/s1 |
| InChIKey | VXCIURLAUWLGFZ-YTWZBVJHSA-N |
| XLogP | 6.18 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|