C31H42N6O5 — CID 67075019
N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(pyridin-4-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(naphthalen-1-ylmethyl)propanamide (PubChem CID 67075019) has the molecular formula C31H42N6O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(pyridin-4-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(naphthalen-1-ylmethyl)propanamide.
| Compound Name | N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(pyridin-4-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(naphthalen-1-ylmethyl)propanamide |
|---|---|
| PubChem CID | 67075019 |
| Molecular Formula | C31H42N6O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(pyridin-4-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(naphthalen-1-ylmethyl)propanamide |
| SMILES | CCOC(OCC)C(C)N(Cc1cccc2ccccc12)C(=O)C(C)NC(=O)CN(C)NC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C31H42N6O5/c1-6-41-30(42-7-2)23(4)37(20-26-13-10-12-25-11-8-9-14-27(25)26)29(39)22(3)34-28(38)21-36(5)35-31(40)33-19-24-15-17-32-18-16-24/h8-18,22-23,30H,6-7,19-21H2,1-5H3,(H,34,38)(H2,33,35,40) |
| InChIKey | IUVIERACAMHXQA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|