C35H44N6O5 — CID 67075203
(2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(quinolin-8-ylmethyl)propanamide (PubChem CID 67075203) has the molecular formula C35H44N6O5 and a molecular weight of 628.77 g/mol. Its IUPAC name is (2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(quinolin-8-ylmethyl)propanamide.
| Compound Name | (2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(quinolin-8-ylmethyl)propanamide |
|---|---|
| PubChem CID | 67075203 |
| Molecular Formula | C35H44N6O5 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | (2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-N-(quinolin-8-ylmethyl)propanamide |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2cccnc12)C(=O)[C@H](C)NC(=O)CN(C)NC(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C35H44N6O5/c1-6-45-34(46-7-2)25(4)41(22-29-17-11-15-27-18-12-20-36-32(27)29)33(43)24(3)38-31(42)23-40(5)39-35(44)37-21-28-16-10-14-26-13-8-9-19-30(26)28/h8-20,24-25,34H,6-7,21-23H2,1-5H3,(H,38,42)(H2,37,39,44)/t24-,25-/m0/s1 |
| InChIKey | VESXPJCFBPPWQV-DQEYMECFSA-N |
| XLogP | 4.36 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|