C24H36N4O5 — CID 67075232
[(5S)-5-amino-6-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid (PubChem CID 67075232) has the molecular formula C24H36N4O5 and a molecular weight of 460.58 g/mol. Its IUPAC name is [(5S)-5-amino-6-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid.
| Compound Name | [(5S)-5-amino-6-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 67075232 |
| Molecular Formula | C24H36N4O5 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | [(5S)-5-amino-6-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2cccnc12)C(=O)[C@@H](N)CCCCNC(=O)O |
| InChI | InChI=1S/C24H36N4O5/c1-4-32-23(33-5-2)17(3)28(22(29)20(25)13-6-7-14-27-24(30)31)16-19-11-8-10-18-12-9-15-26-21(18)19/h8-12,15,17,20,23,27H,4-7,13-14,16,25H2,1-3H3,(H,30,31)/t17-,20-/m0/s1 |
| InChIKey | XZRCIZJIWSQDPR-PXNSSMCTSA-N |
| XLogP | 3.12 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|