C35H48ClN7O7 — CID 67075250
[(5S)-5-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-6-oxohexyl]carbamic acid (PubChem CID 67075250) has the molecular formula C35H48ClN7O7 and a molecular weight of 714.26 g/mol. Its IUPAC name is [(5S)-5-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-6-oxohexyl]carbamic acid.
| Compound Name | [(5S)-5-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 67075250 |
| Molecular Formula | C35H48ClN7O7 |
| Molecular Weight | 714.26 g/mol |
| Exact Mass | 713.33 |
| IUPAC Name | [(5S)-5-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)[C@@H](C)C(NC(=O)[C@H](CCCCNC(=O)O)NC(=O)CN(C)NC(=O)NCc1ccc(Cl)cc1)c1cccc2cccnc12 |
| InChI | InChI=1S/C35H48ClN7O7/c1-5-49-33(50-6-2)23(3)30(27-13-9-11-25-12-10-20-37-31(25)27)41-32(45)28(14-7-8-19-38-35(47)48)40-29(44)22-43(4)42-34(46)39-21-24-15-17-26(36)18-16-24/h9-13,15-18,20,23,28,30,33,38H,5-8,14,19,21-22H2,1-4H3,(H,40,44)(H,41,45)(H,47,48)(H2,39,42,46)/t23-,28-,30?/m0/s1 |
| InChIKey | RAGZFCAXDRNZHT-VMZLPSRASA-N |
| XLogP | 4.35 |
| TPSA | 183.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|