About 5-(2,4-difluorophenyl)-1,2-benzothiazole
5-(2,4-difluorophenyl)-1,2-benzothiazole (PubChem CID 67075296) has the molecular formula C13H7F2NS
and a molecular weight of 247.27 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 5-(2,4-difluorophenyl)-1,2-benzothiazole |
| PubChem CID | 67075296 |
| Molecular Formula | C13H7F2NS |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 5-(2,4-difluorophenyl)-1,2-benzothiazole |
| SMILES | Fc1ccc(-c2ccc3sncc3c2)c(F)c1 |
| InChI | InChI=1S/C13H7F2NS/c14-10-2-3-11(12(15)6-10)8-1-4-13-9(5-8)7-16-17-13/h1-7H |
| InChIKey | FTBGCNSQHUVNIT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,4-difluorophenyl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-difluorophenyl)-1,2-benzothiazole?
The IUPAC name of 5-(2,4-difluorophenyl)-1,2-benzothiazole (CID 67075296) is 5-(2,4-difluorophenyl)-1,2-benzothiazole.
What is the SMILES notation for 5-(2,4-difluorophenyl)-1,2-benzothiazole?
The canonical SMILES for 5-(2,4-difluorophenyl)-1,2-benzothiazole is Fc1ccc(-c2ccc3sncc3c2)c(F)c1.
What is the InChIKey of 5-(2,4-difluorophenyl)-1,2-benzothiazole?
The InChIKey is FTBGCNSQHUVNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F2NS/c14-10-2-3-11(12(15)6-10)8-1-4-13-9(5-8)7-16-17-13/h1-7H.
What are the key properties of 5-(2,4-difluorophenyl)-1,2-benzothiazole?
5-(2,4-difluorophenyl)-1,2-benzothiazole has a molecular weight of 247.27 g/mol, XLogP of 4.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluorophenyl)-1,2-benzothiazole is sourced from PubChem (CID 67075296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).