C28H44N4O5 — CID 67075384
[5-(tert-butylamino)-6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid (PubChem CID 67075384) has the molecular formula C28H44N4O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is [5-(tert-butylamino)-6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid.
| Compound Name | [5-(tert-butylamino)-6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 67075384 |
| Molecular Formula | C28H44N4O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | [5-(tert-butylamino)-6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)C(C)N(Cc1cccc2cccnc12)C(=O)C(CCCCNC(=O)O)NC(C)(C)C |
| InChI | InChI=1S/C28H44N4O5/c1-7-36-26(37-8-2)20(3)32(19-22-14-11-13-21-15-12-18-29-24(21)22)25(33)23(31-28(4,5)6)16-9-10-17-30-27(34)35/h11-15,18,20,23,26,30-31H,7-10,16-17,19H2,1-6H3,(H,34,35) |
| InChIKey | YFYMHROOFSAQOL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|