C46H55N7O6 — CID 67075408
(2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide (PubChem CID 67075408) has the molecular formula C46H55N7O6 and a molecular weight of 801.99 g/mol. Its IUPAC name is (2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide.
| Compound Name | (2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide |
|---|---|
| PubChem CID | 67075408 |
| Molecular Formula | C46H55N7O6 |
| Molecular Weight | 801.99 g/mol |
| Exact Mass | 801.42 |
| IUPAC Name | (2S)-N-[(2S)-1,1-diethoxypropan-2-yl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-N-(quinolin-8-ylmethyl)-N'-tritylbutanediamide |
| SMILES | CCNC(=O)NN(C)CC(=O)N[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N(Cc1cccc2cccnc12)[C@@H](C)C(OCC)OCC |
| InChI | InChI=1S/C46H55N7O6/c1-6-47-45(57)51-52(5)32-41(55)49-39(43(56)53(33(4)44(58-7-2)59-8-3)31-35-21-18-20-34-22-19-29-48-42(34)35)30-40(54)50-46(36-23-12-9-13-24-36,37-25-14-10-15-26-37)38-27-16-11-17-28-38/h9-29,33,39,44H,6-8,30-32H2,1-5H3,(H,49,55)(H,50,54)(H2,47,51,57)/t33-,39-/m0/s1 |
| InChIKey | LZZBFFSJUSXENQ-AJCPBJRWSA-N |
| XLogP | 5.50 |
| TPSA | 154.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.99 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|