C36H39N3O7 — CID 67075463
4-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (PubChem CID 67075463) has the molecular formula C36H39N3O7 and a molecular weight of 625.72 g/mol. Its IUPAC name is 4-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid.
| Compound Name | 4-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67075463 |
| Molecular Formula | C36H39N3O7 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | 4-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| SMILES | CCOC(OCC)C(C)N(Cc1cccc2cccnc12)C(=O)C(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H39N3O7/c1-4-44-35(45-5-2)23(3)39(21-25-13-10-12-24-14-11-19-37-33(24)25)34(42)31(20-32(40)41)38-36(43)46-22-30-28-17-8-6-15-26(28)27-16-7-9-18-29(27)30/h6-19,23,30-31,35H,4-5,20-22H2,1-3H3,(H,38,43)(H,40,41) |
| InChIKey | WQQUYMOQGPJLGR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|