About N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide
N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 67075469) has the molecular formula C19H26FNO3S
and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 67075469 |
| Molecular Formula | C19H26FNO3S |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=CC1(c2ccc(F)cc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C19H26FNO3S/c1-17(2,3)25(22)21-14-18(15-4-6-16(20)7-5-15)8-10-19(11-9-18)23-12-13-24-19/h4-7,14H,8-13H2,1-3H3 |
| InChIKey | HRVWWCAYFITJLC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide (CID 67075469) is N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)N=CC1(c2ccc(F)cc2)CCC2(CC1)OCCO2.
What is the InChIKey of N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is HRVWWCAYFITJLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26FNO3S/c1-17(2,3)25(22)21-14-18(15-4-6-16(20)7-5-15)8-10-19(11-9-18)23-12-13-24-19/h4-7,14H,8-13H2,1-3H3.
What are the key properties of N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide?
N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 367.49 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 67075469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).