C34H41F3N4O8 — CID 67075666
N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,3-oxazol-5-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 67075666) has the molecular formula C34H41F3N4O8 and a molecular weight of 690.72 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,3-oxazol-5-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,3-oxazol-5-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67075666 |
| Molecular Formula | C34H41F3N4O8 |
| Molecular Weight | 690.72 g/mol |
| Exact Mass | 690.29 |
| IUPAC Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,3-oxazol-5-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1COc2c(CCNCCN(C(=O)CCOCCc3cccc(-c4cnco4)c3)C3CCCCC3)ccc(O)c2N1 |
| InChI | InChI=1S/C32H40N4O6.C2HF3O2/c37-27-10-9-24(32-31(27)35-29(38)21-41-32)11-14-33-15-16-36(26-7-2-1-3-8-26)30(39)13-18-40-17-12-23-5-4-6-25(19-23)28-20-34-22-42-28;3-2(4,5)1(6)7/h4-6,9-10,19-20,22,26,33,37H,1-3,7-8,11-18,21H2,(H,35,38);(H,6,7) |
| InChIKey | INXLHEZLUCHYPX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 163.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|