C36H46F3N5O7 — CID 67075767
N-cyclohexyl-3-[2-[3-(1,5-dimethylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 67075767) has the molecular formula C36H46F3N5O7 and a molecular weight of 717.79 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-[3-(1,5-dimethylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclohexyl-3-[2-[3-(1,5-dimethylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67075767 |
| Molecular Formula | C36H46F3N5O7 |
| Molecular Weight | 717.79 g/mol |
| Exact Mass | 717.33 |
| IUPAC Name | N-cyclohexyl-3-[2-[3-(1,5-dimethylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(-c2cccc(CCOCCC(=O)N(CCNCCc3ccc(O)c4c3OCC(=O)N4)C3CCCCC3)c2)cnn1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H45N5O5.C2HF3O2/c1-24-29(22-36-38(24)2)27-8-6-7-25(21-27)14-19-43-20-15-32(42)39(28-9-4-3-5-10-28)18-17-35-16-13-26-11-12-30(40)33-34(26)44-23-31(41)37-33;3-2(4,5)1(6)7/h6-8,11-12,21-22,28,35,40H,3-5,9-10,13-20,23H2,1-2H3,(H,37,41);(H,6,7) |
| InChIKey | NLUFJJIOEHGEER-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 155.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.79 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|