About ethyl N-(1,3-dioxan-5-yl)carbamate
ethyl N-(1,3-dioxan-5-yl)carbamate (PubChem CID 67075992) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is ethyl N-(1,3-dioxan-5-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(1,3-dioxan-5-yl)carbamate |
| PubChem CID | 67075992 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | ethyl N-(1,3-dioxan-5-yl)carbamate |
| SMILES | CCOC(=O)NC1COCOC1 |
| InChI | InChI=1S/C7H13NO4/c1-2-12-7(9)8-6-3-10-5-11-4-6/h6H,2-5H2,1H3,(H,8,9) |
| InChIKey | XMKLKISMWMBNAO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-(1,3-dioxan-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(1,3-dioxan-5-yl)carbamate?
The IUPAC name of ethyl N-(1,3-dioxan-5-yl)carbamate (CID 67075992) is ethyl N-(1,3-dioxan-5-yl)carbamate.
What is the SMILES notation for ethyl N-(1,3-dioxan-5-yl)carbamate?
The canonical SMILES for ethyl N-(1,3-dioxan-5-yl)carbamate is CCOC(=O)NC1COCOC1.
What is the InChIKey of ethyl N-(1,3-dioxan-5-yl)carbamate?
The InChIKey is XMKLKISMWMBNAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-2-12-7(9)8-6-3-10-5-11-4-6/h6H,2-5H2,1H3,(H,8,9).
What are the key properties of ethyl N-(1,3-dioxan-5-yl)carbamate?
ethyl N-(1,3-dioxan-5-yl)carbamate has a molecular weight of 175.18 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(1,3-dioxan-5-yl)carbamate is sourced from PubChem (CID 67075992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).