C12H15NO2 — CID 67076006
3,4,4a,5,5a,6-hexahydro-2H-benzo[g][1,4]benzoxazin-9-ol (PubChem CID 67076006) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3,4,4a,5,5a,6-hexahydro-2H-benzo[g][1,4]benzoxazin-9-ol.
| Compound Name | 3,4,4a,5,5a,6-hexahydro-2H-benzo[g][1,4]benzoxazin-9-ol |
|---|---|
| PubChem CID | 67076006 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3,4,4a,5,5a,6-hexahydro-2H-benzo[g][1,4]benzoxazin-9-ol |
| SMILES | OC1=C2C=C3OCCNC3CC2CC=C1 |
| InChI | InChI=1S/C12H15NO2/c14-11-3-1-2-8-6-10-12(7-9(8)11)15-5-4-13-10/h1,3,7-8,10,13-14H,2,4-6H2 |
| InChIKey | PCUVWYMGBJHQMS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |