About 4-aminopiperidin-2-one;dihydrochloride
4-aminopiperidin-2-one;dihydrochloride (PubChem CID 67076277) has the molecular formula C5H12Cl2N2O
and a molecular weight of 187.07 g/mol. Its IUPAC name is 4-aminopiperidin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 4-aminopiperidin-2-one;dihydrochloride |
| PubChem CID | 67076277 |
| Molecular Formula | C5H12Cl2N2O |
| Molecular Weight | 187.07 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 4-aminopiperidin-2-one;dihydrochloride |
| SMILES | Cl.Cl.NC1CCNC(=O)C1 |
| InChI | InChI=1S/C5H10N2O.2ClH/c6-4-1-2-7-5(8)3-4;;/h4H,1-3,6H2,(H,7,8);2*1H |
| InChIKey | HTIAYDWXSSLYBY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.07 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminopiperidin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopiperidin-2-one;dihydrochloride?
The IUPAC name of 4-aminopiperidin-2-one;dihydrochloride (CID 67076277) is 4-aminopiperidin-2-one;dihydrochloride.
What is the SMILES notation for 4-aminopiperidin-2-one;dihydrochloride?
The canonical SMILES for 4-aminopiperidin-2-one;dihydrochloride is Cl.Cl.NC1CCNC(=O)C1.
What is the InChIKey of 4-aminopiperidin-2-one;dihydrochloride?
The InChIKey is HTIAYDWXSSLYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.2ClH/c6-4-1-2-7-5(8)3-4;;/h4H,1-3,6H2,(H,7,8);2*1H.
What are the key properties of 4-aminopiperidin-2-one;dihydrochloride?
4-aminopiperidin-2-one;dihydrochloride has a molecular weight of 187.07 g/mol, XLogP of 0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopiperidin-2-one;dihydrochloride is sourced from PubChem (CID 67076277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).