C33H40F3N5O8 — CID 67076284
N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 67076284) has the molecular formula C33H40F3N5O8 and a molecular weight of 691.70 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67076284 |
| Molecular Formula | C33H40F3N5O8 |
| Molecular Weight | 691.70 g/mol |
| Exact Mass | 691.28 |
| IUPAC Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1COc2c(CCNCCN(C(=O)CCOCCc3cccc(-c4ncon4)c3)C3CCCCC3)ccc(O)c2N1 |
| InChI | InChI=1S/C31H39N5O6.C2HF3O2/c37-26-10-9-23(30-29(26)34-27(38)20-41-30)11-14-32-15-16-36(25-7-2-1-3-8-25)28(39)13-18-40-17-12-22-5-4-6-24(19-22)31-33-21-42-35-31;3-2(4,5)1(6)7/h4-6,9-10,19,21,25,32,37H,1-3,7-8,11-18,20H2,(H,34,38);(H,6,7) |
| InChIKey | TVTSUVPHCBYARU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 176.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|