C18H14FN3O3S — CID 67076567
12-fluoro-4-methoxy-8-(4-methylphenyl)sulfonyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 67076567) has the molecular formula C18H14FN3O3S and a molecular weight of 371.39 g/mol. Its IUPAC name is 12-fluoro-4-methoxy-8-(4-methylphenyl)sulfonyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-fluoro-4-methoxy-8-(4-methylphenyl)sulfonyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 67076567 |
| Molecular Formula | C18H14FN3O3S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 12-fluoro-4-methoxy-8-(4-methylphenyl)sulfonyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | COc1cc2c3cc(F)cnc3n(S(=O)(=O)c3ccc(C)cc3)c2cn1 |
| InChI | InChI=1S/C18H14FN3O3S/c1-11-3-5-13(6-4-11)26(23,24)22-16-10-20-17(25-2)8-14(16)15-7-12(19)9-21-18(15)22/h3-10H,1-2H3 |
| InChIKey | YBXRTELFAVGZAM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |