C21H22N6O2 — CID 67076588
N-(4-methyl-4-nitropentyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-amine (PubChem CID 67076588) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is N-(4-methyl-4-nitropentyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-amine.
| Compound Name | N-(4-methyl-4-nitropentyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-amine |
|---|---|
| PubChem CID | 67076588 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-(4-methyl-4-nitropentyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-amine |
| SMILES | CC(C)(CCCNc1cnc2[nH]c3cnc(-c4cccnc4)cc3c2c1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N6O2/c1-21(2,27(28)29)6-4-8-23-15-9-17-16-10-18(14-5-3-7-22-11-14)24-13-19(16)26-20(17)25-12-15/h3,5,7,9-13,23H,4,6,8H2,1-2H3,(H,25,26) |
| InChIKey | NYVDCRJUGNKWOR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|