C18H18F3NO3 — CID 67076873
(2S,3S)-2-(dibenzylamino)-4,4,4-trifluoro-3-hydroxybutanoic acid (PubChem CID 67076873) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is (2S,3S)-2-(dibenzylamino)-4,4,4-trifluoro-3-hydroxybutanoic acid.
| Compound Name | (2S,3S)-2-(dibenzylamino)-4,4,4-trifluoro-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 67076873 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2S,3S)-2-(dibenzylamino)-4,4,4-trifluoro-3-hydroxybutanoic acid |
| SMILES | O=C(O)[C@H]([C@H](O)C(F)(F)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H18F3NO3/c19-18(20,21)16(23)15(17(24)25)22(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15-16,23H,11-12H2,(H,24,25)/t15-,16-/m0/s1 |
| InChIKey | XZTZZLAARQRHAR-HOTGVXAUSA-N |
| XLogP | 3.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |