About 1,4-dioxane;quinoline
1,4-dioxane;quinoline (PubChem CID 67077004) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 1,4-dioxane;quinoline.
Molecular Properties
| Compound Name | 1,4-dioxane;quinoline |
| PubChem CID | 67077004 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1,4-dioxane;quinoline |
| SMILES | C1COCCO1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C4H8O2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-6-4-3-5-1/h1-7H;1-4H2 |
| InChIKey | YNZVCDNHTKQCNE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dioxane;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;quinoline?
The IUPAC name of 1,4-dioxane;quinoline (CID 67077004) is 1,4-dioxane;quinoline.
What is the SMILES notation for 1,4-dioxane;quinoline?
The canonical SMILES for 1,4-dioxane;quinoline is C1COCCO1.c1ccc2ncccc2c1.
What is the InChIKey of 1,4-dioxane;quinoline?
The InChIKey is YNZVCDNHTKQCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C4H8O2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-6-4-3-5-1/h1-7H;1-4H2.
What are the key properties of 1,4-dioxane;quinoline?
1,4-dioxane;quinoline has a molecular weight of 217.27 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;quinoline is sourced from PubChem (CID 67077004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).