C27H33N6O4S+ — CID 67077463
(3S)-1-tert-butyl-3-[[5-phenyl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carbonyl]amino]azepan-1-ium-1-carboxylic acid (PubChem CID 67077463) has the molecular formula C27H33N6O4S+ and a molecular weight of 537.67 g/mol. Its IUPAC name is (3S)-1-tert-butyl-3-[[5-phenyl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carbonyl]amino]azepan-1-ium-1-carboxylic acid.
| Compound Name | (3S)-1-tert-butyl-3-[[5-phenyl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carbonyl]amino]azepan-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 67077463 |
| Molecular Formula | C27H33N6O4S+ |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (3S)-1-tert-butyl-3-[[5-phenyl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carbonyl]amino]azepan-1-ium-1-carboxylic acid |
| SMILES | CC(C)(C)[N+]1(C(=O)O)CCCC[C@H](NC(=O)c2cc(-c3ccccc3)sc2NC(=O)Nc2cnccn2)C1 |
| InChI | InChI=1S/C27H32N6O4S/c1-27(2,3)33(26(36)37)14-8-7-11-19(17-33)30-23(34)20-15-21(18-9-5-4-6-10-18)38-24(20)32-25(35)31-22-16-28-12-13-29-22/h4-6,9-10,12-13,15-16,19H,7-8,11,14,17H2,1-3H3,(H3-,29,30,31,32,34,35,36,37)/p+1/t19-,33?/m0/s1 |
| InChIKey | DVVNCMSDGWMDCV-LPEGZLAKSA-O |
| XLogP | 5.42 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|