C57H87BN2O2 — CID 67079035
4-methyl-2-phenyl-7-[4,4,5,5-tetrakis(5-methyl-2-propan-2-ylcyclohexyl)-1,3,2-dioxaborolan-2-yl]quinazoline (PubChem CID 67079035) has the molecular formula C57H87BN2O2 and a molecular weight of 843.15 g/mol. Its IUPAC name is 4-methyl-2-phenyl-7-[4,4,5,5-tetrakis(5-methyl-2-propan-2-ylcyclohexyl)-1,3,2-dioxaborolan-2-yl]quinazoline.
| Compound Name | 4-methyl-2-phenyl-7-[4,4,5,5-tetrakis(5-methyl-2-propan-2-ylcyclohexyl)-1,3,2-dioxaborolan-2-yl]quinazoline |
|---|---|
| PubChem CID | 67079035 |
| Molecular Formula | C57H87BN2O2 |
| Molecular Weight | 843.15 g/mol |
| Exact Mass | 842.69 |
| IUPAC Name | 4-methyl-2-phenyl-7-[4,4,5,5-tetrakis(5-methyl-2-propan-2-ylcyclohexyl)-1,3,2-dioxaborolan-2-yl]quinazoline |
| SMILES | Cc1nc(-c2ccccc2)nc2cc(B3OC(C4CC(C)CCC4C(C)C)(C4CC(C)CCC4C(C)C)C(C4CC(C)CCC4C(C)C)(C4CC(C)CCC4C(C)C)O3)ccc12 |
| InChI | InChI=1S/C57H87BN2O2/c1-34(2)45-24-19-38(9)29-50(45)56(51-30-39(10)20-25-46(51)35(3)4)57(52-31-40(11)21-26-47(52)36(5)6,53-32-41(12)22-27-48(53)37(7)8)62-58(61-56)44-23-28-49-42(13)59-55(60-54(49)33-44)43-17-15-14-16-18-43/h14-18,23,28,33-41,45-48,50-53H,19-22,24-27,29-32H2,1-13H3 |
| InChIKey | OZUDWUYGWUBLHZ-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.15 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|