About 4-prop-2-enyl-2,3-dihydro-1-benzofuran
4-prop-2-enyl-2,3-dihydro-1-benzofuran (PubChem CID 67079342) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-prop-2-enyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 4-prop-2-enyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 67079342 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 4-prop-2-enyl-2,3-dihydro-1-benzofuran |
| SMILES | C=CCc1cccc2c1CCO2 |
| InChI | InChI=1S/C11H12O/c1-2-4-9-5-3-6-11-10(9)7-8-12-11/h2-3,5-6H,1,4,7-8H2 |
| InChIKey | NLEWJYKFZKFOSS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 4-prop-2-enyl-2,3-dihydro-1-benzofuran (CID 67079342) is 4-prop-2-enyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 4-prop-2-enyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 4-prop-2-enyl-2,3-dihydro-1-benzofuran is C=CCc1cccc2c1CCO2.
What is the InChIKey of 4-prop-2-enyl-2,3-dihydro-1-benzofuran?
The InChIKey is NLEWJYKFZKFOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-2-4-9-5-3-6-11-10(9)7-8-12-11/h2-3,5-6H,1,4,7-8H2.
What are the key properties of 4-prop-2-enyl-2,3-dihydro-1-benzofuran?
4-prop-2-enyl-2,3-dihydro-1-benzofuran has a molecular weight of 160.22 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 67079342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).