C33H32N2O2Si2 — CID 67079489
1-[3-(2,2,5,5-tetraphenyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-dione (PubChem CID 67079489) has the molecular formula C33H32N2O2Si2 and a molecular weight of 544.80 g/mol. Its IUPAC name is 1-[3-(2,2,5,5-tetraphenyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-(2,2,5,5-tetraphenyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67079489 |
| Molecular Formula | C33H32N2O2Si2 |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 1-[3-(2,2,5,5-tetraphenyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCN1[Si](c2ccccc2)(c2ccccc2)CC[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32N2O2Si2/c36-32-22-23-33(37)34(32)24-13-25-35-38(28-14-5-1-6-15-28,29-16-7-2-8-17-29)26-27-39(35,30-18-9-3-10-19-30)31-20-11-4-12-21-31/h1-12,14-23H,13,24-27H2 |
| InChIKey | KMTBNIZAHDFXIS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|