C13H28N2O2Si2 — CID 67079677
1-[3-[bis(trimethylsilyl)amino]propyl]pyrrolidine-2,5-dione (PubChem CID 67079677) has the molecular formula C13H28N2O2Si2 and a molecular weight of 300.55 g/mol. Its IUPAC name is 1-[3-[bis(trimethylsilyl)amino]propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[bis(trimethylsilyl)amino]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67079677 |
| Molecular Formula | C13H28N2O2Si2 |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-[3-[bis(trimethylsilyl)amino]propyl]pyrrolidine-2,5-dione |
| SMILES | C[Si](C)(C)N(CCCN1C(=O)CCC1=O)[Si](C)(C)C |
| InChI | InChI=1S/C13H28N2O2Si2/c1-18(2,3)15(19(4,5)6)11-7-10-14-12(16)8-9-13(14)17/h7-11H2,1-6H3 |
| InChIKey | RPQSJJXRWWMGME-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|