C15H26FNO4Si — CID 67080041
(3S,4R)-3-[(1S)-2-fluoro-1-trimethylsilyloxyethyl]-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one (PubChem CID 67080041) has the molecular formula C15H26FNO4Si and a molecular weight of 331.46 g/mol. Its IUPAC name is (3S,4R)-3-[(1S)-2-fluoro-1-trimethylsilyloxyethyl]-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[(1S)-2-fluoro-1-trimethylsilyloxyethyl]-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one |
|---|---|
| PubChem CID | 67080041 |
| Molecular Formula | C15H26FNO4Si |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3S,4R)-3-[(1S)-2-fluoro-1-trimethylsilyloxyethyl]-4-[(1R,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one |
| SMILES | CO[C@H]1CCC[C@H]([C@H]2NC(=O)[C@@H]2[C@@H](CF)O[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C15H26FNO4Si/c1-20-10-7-5-6-9(14(10)18)13-12(15(19)17-13)11(8-16)21-22(2,3)4/h9-13H,5-8H2,1-4H3,(H,17,19)/t9-,10+,11-,12-,13-/m1/s1 |
| InChIKey | KKRQWVBNZUKZCC-NZEXEKPDSA-N |
| XLogP | 1.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|