About but-1-ene;1-ethenylpyrrolidin-2-one
but-1-ene;1-ethenylpyrrolidin-2-one (PubChem CID 67080053) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is but-1-ene;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | but-1-ene;1-ethenylpyrrolidin-2-one |
| PubChem CID | 67080053 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | but-1-ene;1-ethenylpyrrolidin-2-one |
| SMILES | C=CCC.C=CN1CCCC1=O |
| InChI | InChI=1S/C6H9NO.C4H8/c1-2-7-5-3-4-6(7)8;1-3-4-2/h2H,1,3-5H2;3H,1,4H2,2H3 |
| InChIKey | VHHVTXIVVKCDQS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;1-ethenylpyrrolidin-2-one?
The IUPAC name of but-1-ene;1-ethenylpyrrolidin-2-one (CID 67080053) is but-1-ene;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for but-1-ene;1-ethenylpyrrolidin-2-one?
The canonical SMILES for but-1-ene;1-ethenylpyrrolidin-2-one is C=CCC.C=CN1CCCC1=O.
What is the InChIKey of but-1-ene;1-ethenylpyrrolidin-2-one?
The InChIKey is VHHVTXIVVKCDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H8/c1-2-7-5-3-4-6(7)8;1-3-4-2/h2H,1,3-5H2;3H,1,4H2,2H3.
What are the key properties of but-1-ene;1-ethenylpyrrolidin-2-one?
but-1-ene;1-ethenylpyrrolidin-2-one has a molecular weight of 167.25 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 67080053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).