About 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one
2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one (PubChem CID 67080138) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one.
Analyze 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one?
The IUPAC name of 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one (CID 67080138) is 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one.
What is the SMILES notation for 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one?
The canonical SMILES for 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one is O=C1C=Cc2cccc(c2)N1.
What is the InChIKey of 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one?
The InChIKey is SIVUBGNSJMLSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c11-9-5-4-7-2-1-3-8(6-7)10-9/h1-6H,(H,10,11).
What are the key properties of 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one?
2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one has a molecular weight of 145.16 g/mol, XLogP of 1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[4.3.1]deca-1(9),4,6(10),7-tetraen-3-one is sourced from PubChem (CID 67080138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).