C19H34N2O2Si — CID 67080544
2-[3-(2,2-diethylazasilinan-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 67080544) has the molecular formula C19H34N2O2Si and a molecular weight of 350.58 g/mol. Its IUPAC name is 2-[3-(2,2-diethylazasilinan-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[3-(2,2-diethylazasilinan-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67080544 |
| Molecular Formula | C19H34N2O2Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-[3-(2,2-diethylazasilinan-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC[Si]1(CC)CCCCN1CCCN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H34N2O2Si/c1-3-24(4-2)15-8-7-12-20(24)13-9-14-21-18(22)16-10-5-6-11-17(16)19(21)23/h16-17H,3-15H2,1-2H3 |
| InChIKey | FBMYYBKTLNKAMM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|