C24H25F3N4OS — CID 67080826
N-[2,5-dimethyl-4-[[3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-1-piperidin-1-ylmethanimine (PubChem CID 67080826) has the molecular formula C24H25F3N4OS and a molecular weight of 474.55 g/mol. Its IUPAC name is N-[2,5-dimethyl-4-[[3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-1-piperidin-1-ylmethanimine.
| Compound Name | N-[2,5-dimethyl-4-[[3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-1-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 67080826 |
| Molecular Formula | C24H25F3N4OS |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[2,5-dimethyl-4-[[3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]-1-piperidin-1-ylmethanimine |
| SMILES | Cc1cc(Oc2nc(Cc3cccc(C(F)(F)F)c3)ns2)c(C)cc1/N=C/N1CCCCC1 |
| InChI | InChI=1S/C24H25F3N4OS/c1-16-12-21(17(2)11-20(16)28-15-31-9-4-3-5-10-31)32-23-29-22(30-33-23)14-18-7-6-8-19(13-18)24(25,26)27/h6-8,11-13,15H,3-5,9-10,14H2,1-2H3/b28-15+ |
| InChIKey | LUYULDPOWZVFFZ-RWPZCVJISA-N |
| XLogP | 6.70 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|