C21H22F2N4OS — CID 67080912
N'-[4-[[3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 67080912) has the molecular formula C21H22F2N4OS and a molecular weight of 416.50 g/mol. Its IUPAC name is N'-[4-[[3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 67080912 |
| Molecular Formula | C21H22F2N4OS |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N'-[4-[[3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2nc(Cc3ccc(F)cc3F)ns2)cc1C |
| InChI | InChI=1S/C21H22F2N4OS/c1-5-27(4)12-24-18-8-14(3)19(9-13(18)2)28-21-25-20(26-29-21)10-15-6-7-16(22)11-17(15)23/h6-9,11-12H,5,10H2,1-4H3/b24-12+ |
| InChIKey | XFVPWXNUTAESGD-WYMPLXKRSA-N |
| XLogP | 5.43 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|