About pentyl imidazole-1-carboxylate
pentyl imidazole-1-carboxylate (PubChem CID 67081350) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is pentyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | pentyl imidazole-1-carboxylate |
| PubChem CID | 67081350 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | pentyl imidazole-1-carboxylate |
| SMILES | CCCCCOC(=O)n1ccnc1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-4-7-13-9(12)11-6-5-10-8-11/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | ZSGUTMRPWMEMAS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl imidazole-1-carboxylate?
The IUPAC name of pentyl imidazole-1-carboxylate (CID 67081350) is pentyl imidazole-1-carboxylate.
What is the SMILES notation for pentyl imidazole-1-carboxylate?
The canonical SMILES for pentyl imidazole-1-carboxylate is CCCCCOC(=O)n1ccnc1.
What is the InChIKey of pentyl imidazole-1-carboxylate?
The InChIKey is ZSGUTMRPWMEMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-2-3-4-7-13-9(12)11-6-5-10-8-11/h5-6,8H,2-4,7H2,1H3.
What are the key properties of pentyl imidazole-1-carboxylate?
pentyl imidazole-1-carboxylate has a molecular weight of 182.22 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl imidazole-1-carboxylate is sourced from PubChem (CID 67081350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).