C12H12N2 — CID 67081883
2-[1-(3-methylphenyl)ethenyl]-1H-imidazole (PubChem CID 67081883) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-[1-(3-methylphenyl)ethenyl]-1H-imidazole.
| Compound Name | 2-[1-(3-methylphenyl)ethenyl]-1H-imidazole |
|---|---|
| PubChem CID | 67081883 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-[1-(3-methylphenyl)ethenyl]-1H-imidazole |
| SMILES | C=C(c1cccc(C)c1)c1ncc[nH]1 |
| InChI | InChI=1S/C12H12N2/c1-9-4-3-5-11(8-9)10(2)12-13-6-7-14-12/h3-8H,2H2,1H3,(H,13,14) |
| InChIKey | TUXDRFXCLGQTJF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |