C18H11N5O2 — CID 67082315
3,4-bis(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrrole-2,5-dione (PubChem CID 67082315) has the molecular formula C18H11N5O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3,4-bis(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67082315 |
| Molecular Formula | C18H11N5O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3,4-bis(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cc3cccnc3[nH]2)=C1c1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C18H11N5O2/c24-17-13(11-7-9-3-1-5-19-15(9)21-11)14(18(25)23-17)12-8-10-4-2-6-20-16(10)22-12/h1-8H,(H,19,21)(H,20,22)(H,23,24,25) |
| InChIKey | IMCMOBYGKAJDGW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|